C18H27NO4 — CID 164889826
methyl (2S)-2-[(3'aR,6'R,7'R,7'aR)-7'-cyano-6',7'-dimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]propanoate (PubChem CID 164889826) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is methyl (2S)-2-[(3'aR,6'R,7'R,7'aR)-7'-cyano-6',7'-dimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]propanoate.
| Compound Name | methyl (2S)-2-[(3'aR,6'R,7'R,7'aR)-7'-cyano-6',7'-dimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]propanoate |
|---|---|
| PubChem CID | 164889826 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | methyl (2S)-2-[(3'aR,6'R,7'R,7'aR)-7'-cyano-6',7'-dimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@@]12CC[C@@H](C)[C@@](C)(C#N)[C@@H]1C1(CC2)OCCO1 |
| InChI | InChI=1S/C18H27NO4/c1-12-5-6-17(13(2)14(20)21-4)7-8-18(22-9-10-23-18)15(17)16(12,3)11-19/h12-13,15H,5-10H2,1-4H3/t12-,13-,15+,16-,17+/m1/s1 |
| InChIKey | XEWSRBLTPAECJD-GJVDQKBNSA-N |
| XLogP | 2.89 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |