C16H23NO4 — CID 134961660
methyl (3aR,4R,5R,7aR)-7a-cyano-4,5-dimethylspiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-carboxylate (PubChem CID 134961660) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is methyl (3aR,4R,5R,7aR)-7a-cyano-4,5-dimethylspiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-carboxylate.
| Compound Name | methyl (3aR,4R,5R,7aR)-7a-cyano-4,5-dimethylspiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-carboxylate |
|---|---|
| PubChem CID | 134961660 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methyl (3aR,4R,5R,7aR)-7a-cyano-4,5-dimethylspiro[1,2,3a,5,6,7-hexahydroindene-3,2'-1,3-dioxolane]-4-carboxylate |
| SMILES | COC(=O)[C@]1(C)[C@H](C)CC[C@@]2(C#N)CCC3(OCCO3)[C@H]21 |
| InChI | InChI=1S/C16H23NO4/c1-11-4-5-15(10-17)6-7-16(20-8-9-21-16)12(15)14(11,2)13(18)19-3/h11-12H,4-9H2,1-3H3/t11-,12+,14-,15+/m1/s1 |
| InChIKey | SQIYOZIDNMRMFE-OSRDXIQISA-N |
| XLogP | 2.26 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |