C16H21NO4 — CID 153280878
(3'aR,6'R,7'R,7'aR)-6',7'-dimethyl-7'-oxaldehydoylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-carbonitrile (PubChem CID 153280878) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (3'aR,6'R,7'R,7'aR)-6',7'-dimethyl-7'-oxaldehydoylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-carbonitrile.
| Compound Name | (3'aR,6'R,7'R,7'aR)-6',7'-dimethyl-7'-oxaldehydoylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-carbonitrile |
|---|---|
| PubChem CID | 153280878 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (3'aR,6'R,7'R,7'aR)-6',7'-dimethyl-7'-oxaldehydoylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-carbonitrile |
| SMILES | C[C@@H]1CC[C@@]2(C#N)CCC3(OCCO3)[C@H]2[C@]1(C)C(=O)C=O |
| InChI | InChI=1S/C16H21NO4/c1-11-3-4-15(10-17)5-6-16(20-7-8-21-16)13(15)14(11,2)12(19)9-18/h9,11,13H,3-8H2,1-2H3/t11-,13+,14+,15+/m1/s1 |
| InChIKey | FTHNACUDLNTHBG-UNQGMJICSA-N |
| XLogP | 1.85 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|