C17H25NO4 — CID 164889815
methyl 2-[(3'aS,6'R,7'R,7'aR)-7'-cyano-6',7'-dimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]acetate (PubChem CID 164889815) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl 2-[(3'aS,6'R,7'R,7'aR)-7'-cyano-6',7'-dimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]acetate.
| Compound Name | methyl 2-[(3'aS,6'R,7'R,7'aR)-7'-cyano-6',7'-dimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]acetate |
|---|---|
| PubChem CID | 164889815 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | methyl 2-[(3'aS,6'R,7'R,7'aR)-7'-cyano-6',7'-dimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]acetate |
| SMILES | COC(=O)C[C@@]12CC[C@@H](C)[C@@](C)(C#N)[C@@H]1C1(CC2)OCCO1 |
| InChI | InChI=1S/C17H25NO4/c1-12-4-5-16(10-13(19)20-3)6-7-17(21-8-9-22-17)14(16)15(12,2)11-18/h12,14H,4-10H2,1-3H3/t12-,14+,15-,16+/m1/s1 |
| InChIKey | JJEPMIDWALLOIO-BVUBDWEXSA-N |
| XLogP | 2.65 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |