C19H29NO4 — CID 164889827
methyl (2S)-2-[(3'aS,5'S,6'R,7'R,7'aR)-7'-cyano-5',6',7'-trimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]propanoate (PubChem CID 164889827) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is methyl (2S)-2-[(3'aS,5'S,6'R,7'R,7'aR)-7'-cyano-5',6',7'-trimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]propanoate.
| Compound Name | methyl (2S)-2-[(3'aS,5'S,6'R,7'R,7'aR)-7'-cyano-5',6',7'-trimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]propanoate |
|---|---|
| PubChem CID | 164889827 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | methyl (2S)-2-[(3'aS,5'S,6'R,7'R,7'aR)-7'-cyano-5',6',7'-trimethylspiro[1,3-dioxolane-2,1'-2,3,4,5,6,7a-hexahydroindene]-3'a-yl]propanoate |
| SMILES | COC(=O)[C@@H](C)[C@]12CCC3(OCCO3)[C@H]1[C@](C)(C#N)[C@H](C)[C@@H](C)C2 |
| InChI | InChI=1S/C19H29NO4/c1-12-10-18(14(3)15(21)22-5)6-7-19(23-8-9-24-19)16(18)17(4,11-20)13(12)2/h12-14,16H,6-10H2,1-5H3/t12-,13+,14+,16-,17+,18+/m0/s1 |
| InChIKey | NBDXIXBYLKFVNT-HJOKPGJRSA-N |
| XLogP | 3.14 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |