C17H25NO4 — CID 164889839
methyl (2R)-2-[(1'R,2'R,3'aS,6'aR)-1'-cyano-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-3'a-yl]propanoate (PubChem CID 164889839) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl (2R)-2-[(1'R,2'R,3'aS,6'aR)-1'-cyano-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-3'a-yl]propanoate.
| Compound Name | methyl (2R)-2-[(1'R,2'R,3'aS,6'aR)-1'-cyano-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-3'a-yl]propanoate |
|---|---|
| PubChem CID | 164889839 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | methyl (2R)-2-[(1'R,2'R,3'aS,6'aR)-1'-cyano-1',2'-dimethylspiro[1,3-dioxolane-2,6'-3,4,5,6a-tetrahydro-2H-pentalene]-3'a-yl]propanoate |
| SMILES | COC(=O)[C@H](C)[C@]12CCC3(OCCO3)[C@H]1[C@](C)(C#N)[C@H](C)C2 |
| InChI | InChI=1S/C17H25NO4/c1-11-9-16(12(2)13(19)20-4)5-6-17(21-7-8-22-17)14(16)15(11,3)10-18/h11-12,14H,5-9H2,1-4H3/t11-,12+,14+,15-,16-/m1/s1 |
| InChIKey | BEFMZSZVFXNRAW-XVLPMQGWSA-N |
| XLogP | 2.50 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |