C20H26F6O6 — CID 91174029
1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-methyl-2-propan-2-ylpentanoyl)oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carboxylate (PubChem CID 91174029) has the molecular formula C20H26F6O6 and a molecular weight of 476.41 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-methyl-2-propan-2-ylpentanoyl)oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-methyl-2-propan-2-ylpentanoyl)oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carboxylate |
|---|---|
| PubChem CID | 91174029 |
| Molecular Formula | C20H26F6O6 |
| Molecular Weight | 476.41 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 5-(2-methyl-2-propan-2-ylpentanoyl)oxy-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-3-carboxylate |
| SMILES | CCCC(C)(C(=O)OC1CC2OC(=O)C(C(=O)OC(C(F)(F)F)C(F)(F)F)C2C1)C(C)C |
| InChI | InChI=1S/C20H26F6O6/c1-5-6-18(4,9(2)3)17(29)30-10-7-11-12(8-10)31-14(27)13(11)15(28)32-16(19(21,22)23)20(24,25)26/h9-13,16H,5-8H2,1-4H3 |
| InChIKey | UTOMJQAPZSJIDC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|