C40H47F2N9O — CID 123444608
N-[3-fluoro-2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]-4-[2-[4-[3-(pyridin-2-ylamino)propyl]piperazin-1-yl]phenoxy]butyl]quinolin-2-amine (PubChem CID 123444608) has the molecular formula C40H47F2N9O and a molecular weight of 707.87 g/mol. Its IUPAC name is N-[3-fluoro-2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]-4-[2-[4-[3-(pyridin-2-ylamino)propyl]piperazin-1-yl]phenoxy]butyl]quinolin-2-amine.
| Compound Name | N-[3-fluoro-2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]-4-[2-[4-[3-(pyridin-2-ylamino)propyl]piperazin-1-yl]phenoxy]butyl]quinolin-2-amine |
|---|---|
| PubChem CID | 123444608 |
| Molecular Formula | C40H47F2N9O |
| Molecular Weight | 707.87 g/mol |
| Exact Mass | 707.39 |
| IUPAC Name | N-[3-fluoro-2-[4-(6-fluoro-2-pyridinyl)piperazin-1-yl]-4-[2-[4-[3-(pyridin-2-ylamino)propyl]piperazin-1-yl]phenoxy]butyl]quinolin-2-amine |
| SMILES | Fc1cccc(N2CCN(C(CNc3ccc4ccccc4n3)C(F)COc3ccccc3N3CCN(CCCNc4ccccn4)CC3)CC2)n1 |
| InChI | InChI=1S/C40H47F2N9O/c41-32(30-52-36-12-4-3-11-34(36)49-23-21-48(22-24-49)20-8-19-44-38-14-5-6-18-43-38)35(29-45-39-17-16-31-9-1-2-10-33(31)46-39)50-25-27-51(28-26-50)40-15-7-13-37(42)47-40/h1-7,9-18,32,35H,8,19-30H2,(H,43,44)(H,45,46) |
| InChIKey | ULYBCSCNEZZDSJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 84.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.87 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|