C25H26ClNO3 — CID 123446442
carbon dioxide;2-chloro-N-[2-(3-cyclohexyl-6-methyl-1H-inden-2-yl)phenyl]acetamide (PubChem CID 123446442) has the molecular formula C25H26ClNO3 and a molecular weight of 423.94 g/mol. Its IUPAC name is carbon dioxide;2-chloro-N-[2-(3-cyclohexyl-6-methyl-1H-inden-2-yl)phenyl]acetamide.
| Compound Name | carbon dioxide;2-chloro-N-[2-(3-cyclohexyl-6-methyl-1H-inden-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 123446442 |
| Molecular Formula | C25H26ClNO3 |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | carbon dioxide;2-chloro-N-[2-(3-cyclohexyl-6-methyl-1H-inden-2-yl)phenyl]acetamide |
| SMILES | Cc1ccc2c(c1)CC(c1ccccc1NC(=O)CCl)=C2C1CCCCC1.O=C=O |
| InChI | InChI=1S/C24H26ClNO.CO2/c1-16-11-12-19-18(13-16)14-21(24(19)17-7-3-2-4-8-17)20-9-5-6-10-22(20)26-23(27)15-25;2-1-3/h5-6,9-13,17H,2-4,7-8,14-15H2,1H3,(H,26,27); |
| InChIKey | OAPCLFHEKHXYTD-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|