C25H28ClNO — CID 123675940
2-chloro-N-[2-(3-cyclohexyl-6-methyl-1H-inden-2-yl)-5-methylphenyl]acetamide (PubChem CID 123675940) has the molecular formula C25H28ClNO and a molecular weight of 393.96 g/mol. Its IUPAC name is 2-chloro-N-[2-(3-cyclohexyl-6-methyl-1H-inden-2-yl)-5-methylphenyl]acetamide.
| Compound Name | 2-chloro-N-[2-(3-cyclohexyl-6-methyl-1H-inden-2-yl)-5-methylphenyl]acetamide |
|---|---|
| PubChem CID | 123675940 |
| Molecular Formula | C25H28ClNO |
| Molecular Weight | 393.96 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-chloro-N-[2-(3-cyclohexyl-6-methyl-1H-inden-2-yl)-5-methylphenyl]acetamide |
| SMILES | Cc1ccc2c(c1)CC(c1ccc(C)cc1NC(=O)CCl)=C2C1CCCCC1 |
| InChI | InChI=1S/C25H28ClNO/c1-16-8-10-20-19(12-16)14-22(25(20)18-6-4-3-5-7-18)21-11-9-17(2)13-23(21)27-24(28)15-26/h8-13,18H,3-7,14-15H2,1-2H3,(H,27,28) |
| InChIKey | ABOSIOTVJVGZFG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.96 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|