C24H29ClN2O3S — CID 143093961
2-[2-[(2-chloroacetyl)amino]-4-methylphenyl]-3-cyclohexyl-3a-methyl-1,4-dihydroindole-6-sulfinic acid (PubChem CID 143093961) has the molecular formula C24H29ClN2O3S and a molecular weight of 461.03 g/mol. Its IUPAC name is 2-[2-[(2-chloroacetyl)amino]-4-methylphenyl]-3-cyclohexyl-3a-methyl-1,4-dihydroindole-6-sulfinic acid.
| Compound Name | 2-[2-[(2-chloroacetyl)amino]-4-methylphenyl]-3-cyclohexyl-3a-methyl-1,4-dihydroindole-6-sulfinic acid |
|---|---|
| PubChem CID | 143093961 |
| Molecular Formula | C24H29ClN2O3S |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[2-[(2-chloroacetyl)amino]-4-methylphenyl]-3-cyclohexyl-3a-methyl-1,4-dihydroindole-6-sulfinic acid |
| SMILES | Cc1ccc(C2=C(C3CCCCC3)C3(C)CC=C(S(=O)O)C=C3N2)c(NC(=O)CCl)c1 |
| InChI | InChI=1S/C24H29ClN2O3S/c1-15-8-9-18(19(12-15)26-21(28)14-25)23-22(16-6-4-3-5-7-16)24(2)11-10-17(31(29)30)13-20(24)27-23/h8-10,12-13,16,27H,3-7,11,14H2,1-2H3,(H,26,28)(H,29,30) |
| InChIKey | VXEFTCSNELUESN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|