C5H6N4O — CID 123446836
(5-methoxy-1,2,4-triazin-6-yl)methanimine (PubChem CID 123446836) has the molecular formula C5H6N4O and a molecular weight of 138.13 g/mol. Its IUPAC name is (5-methoxy-1,2,4-triazin-6-yl)methanimine.
| Compound Name | (5-methoxy-1,2,4-triazin-6-yl)methanimine |
|---|---|
| PubChem CID | 123446836 |
| Molecular Formula | C5H6N4O |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | (5-methoxy-1,2,4-triazin-6-yl)methanimine |
| SMILES | [H]/N=C/c1nncnc1OC |
| InChI | InChI=1S/C5H6N4O/c1-10-5-4(2-6)9-8-3-7-5/h2-3,6H,1H3/b6-2+ |
| InChIKey | PRQIJSMRSWVIRZ-QHHAFSJGSA-N |
| XLogP | -0.12 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|