C38H14F10N2O8S2 — CID 123450138
[2,5-bis(2-cyano-3-oxo-3-phenylprop-1-enyl)-4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate (PubChem CID 123450138) has the molecular formula C38H14F10N2O8S2 and a molecular weight of 880.65 g/mol. Its IUPAC name is [2,5-bis(2-cyano-3-oxo-3-phenylprop-1-enyl)-4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate.
| Compound Name | [2,5-bis(2-cyano-3-oxo-3-phenylprop-1-enyl)-4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
|---|---|
| PubChem CID | 123450138 |
| Molecular Formula | C38H14F10N2O8S2 |
| Molecular Weight | 880.65 g/mol |
| Exact Mass | 880.00 |
| IUPAC Name | [2,5-bis(2-cyano-3-oxo-3-phenylprop-1-enyl)-4-(2,3,4,5,6-pentafluorophenyl)sulfonyloxyphenyl] 2,3,4,5,6-pentafluorobenzenesulfonate |
| SMILES | N#CC(=Cc1cc(OS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c(C=C(C#N)C(=O)c2ccccc2)cc1OS(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C38H14F10N2O8S2/c39-25-27(41)31(45)37(32(46)28(25)42)59(53,54)57-23-14-20(12-22(16-50)36(52)18-9-5-2-6-10-18)24(13-19(23)11-21(15-49)35(51)17-7-3-1-4-8-17)58-60(55,56)38-33(47)29(43)26(40)30(44)34(38)48/h1-14H |
| InChIKey | VJITZRLCZDREDL-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 168.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.65 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|