C18H19Cl2NOS2 — CID 123451427
2-(4-chlorophenyl)sulfanyl-N-[2-(4-chlorophenyl)sulfanylethyl]-2-methylpropanamide (PubChem CID 123451427) has the molecular formula C18H19Cl2NOS2 and a molecular weight of 400.40 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-[2-(4-chlorophenyl)sulfanylethyl]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-[2-(4-chlorophenyl)sulfanylethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 123451427 |
| Molecular Formula | C18H19Cl2NOS2 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-[2-(4-chlorophenyl)sulfanylethyl]-2-methylpropanamide |
| SMILES | CC(C)(Sc1ccc(Cl)cc1)C(=O)NCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2NOS2/c1-18(2,24-16-9-5-14(20)6-10-16)17(22)21-11-12-23-15-7-3-13(19)4-8-15/h3-10H,11-12H2,1-2H3,(H,21,22) |
| InChIKey | VPOSIWUTDZFWHG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|