C23H33N7O — CID 123451882
1-[7-[2-amino-5-[1-[amino(methyl)amino]but-1-en-2-yl]benzenecarboximidoyl]-5H-1,3-diazepin-4-yl]-3-methylpiperidin-3-ol (PubChem CID 123451882) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 1-[7-[2-amino-5-[1-[amino(methyl)amino]but-1-en-2-yl]benzenecarboximidoyl]-5H-1,3-diazepin-4-yl]-3-methylpiperidin-3-ol.
| Compound Name | 1-[7-[2-amino-5-[1-[amino(methyl)amino]but-1-en-2-yl]benzenecarboximidoyl]-5H-1,3-diazepin-4-yl]-3-methylpiperidin-3-ol |
|---|---|
| PubChem CID | 123451882 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 1-[7-[2-amino-5-[1-[amino(methyl)amino]but-1-en-2-yl]benzenecarboximidoyl]-5H-1,3-diazepin-4-yl]-3-methylpiperidin-3-ol |
| SMILES | [H]/N=C(\C1=CCC(N2CCCC(C)(O)C2)=NC=N1)c1cc(C(=CN(C)N)CC)ccc1N |
| InChI | InChI=1S/C23H33N7O/c1-4-16(13-29(3)26)17-6-7-19(24)18(12-17)22(25)20-8-9-21(28-15-27-20)30-11-5-10-23(2,31)14-30/h6-8,12-13,15,25,31H,4-5,9-11,14,24,26H2,1-3H3/b16-13?,25-22- |
| InChIKey | MHGPDHDMWIXRFB-LPSWZIDTSA-N |
| XLogP | 2.75 |
| TPSA | 127.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|