C16H36N6Na2O9P2+2 — CID 123452847
disodium;[[2-[2-[3-[2-[3-(ethylamino)propanoylamino]ethylamino]propanoylamino]ethylamino]-2-oxoethyl]-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 123452847) has the molecular formula C16H36N6Na2O9P2+2 and a molecular weight of 564.43 g/mol. Its IUPAC name is disodium;[[2-[2-[3-[2-[3-(ethylamino)propanoylamino]ethylamino]propanoylamino]ethylamino]-2-oxoethyl]-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | disodium;[[2-[2-[3-[2-[3-(ethylamino)propanoylamino]ethylamino]propanoylamino]ethylamino]-2-oxoethyl]-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 123452847 |
| Molecular Formula | C16H36N6Na2O9P2+2 |
| Molecular Weight | 564.43 g/mol |
| Exact Mass | 564.18 |
| IUPAC Name | disodium;[[2-[2-[3-[2-[3-(ethylamino)propanoylamino]ethylamino]propanoylamino]ethylamino]-2-oxoethyl]-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | CCNCCC(=O)NCCNCCC(=O)NCCNC(=O)CN(C[P+]([O-])(O)O)C[P+]([O-])(O)O.[Na+].[Na+] |
| InChI | InChI=1S/C16H36N6O9P2.2Na/c1-2-17-5-3-14(23)19-8-7-18-6-4-15(24)20-9-10-21-16(25)11-22(12-32(26,27)28)13-33(29,30)31;;/h17-18H,2-13H2,1H3,(H,19,23)(H,20,24)(H,21,25)(H2,26,27,28)(H2,29,30,31);;/q;2*+1 |
| InChIKey | WOQZTNSMVWJGGN-UHFFFAOYSA-N |
| XLogP | -11.25 |
| TPSA | 241.64 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.43 |
| LogP ≤ 5 | -11.25 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|