C13H32N4Na2O7P2+2 — CID 123277985
disodium;[[2-oxo-2-[3-[3-(propylamino)propylamino]propylamino]ethyl]-(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 123277985) has the molecular formula C13H32N4Na2O7P2+2 and a molecular weight of 464.35 g/mol. Its IUPAC name is disodium;[[2-oxo-2-[3-[3-(propylamino)propylamino]propylamino]ethyl]-(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | disodium;[[2-oxo-2-[3-[3-(propylamino)propylamino]propylamino]ethyl]-(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 123277985 |
| Molecular Formula | C13H32N4Na2O7P2+2 |
| Molecular Weight | 464.35 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | disodium;[[2-oxo-2-[3-[3-(propylamino)propylamino]propylamino]ethyl]-(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | CCCNCCCNCCCNC(=O)CN(C[P+]([O-])(O)O)C[P+]([O-])(O)O.[Na+].[Na+] |
| InChI | InChI=1S/C13H32N4O7P2.2Na/c1-2-5-14-6-3-7-15-8-4-9-16-13(18)10-17(11-25(19,20)21)12-26(22,23)24;;/h14-15H,2-12H2,1H3,(H,16,18)(H2,19,20,21)(H2,22,23,24);;/q;2*+1 |
| InChIKey | CZWATQJQDXFEEP-UHFFFAOYSA-N |
| XLogP | -9.09 |
| TPSA | 183.44 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.35 |
| LogP ≤ 5 | -9.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|