C12H31N3O7P2+2 — CID 91319208
trihydroxy-[[[4-oxo-4-[3-(propylamino)propylamino]butyl]-(trihydroxyphosphaniumylmethyl)amino]methyl]phosphanium (PubChem CID 91319208) has the molecular formula C12H31N3O7P2+2 and a molecular weight of 391.34 g/mol. Its IUPAC name is trihydroxy-[[[4-oxo-4-[3-(propylamino)propylamino]butyl]-(trihydroxyphosphaniumylmethyl)amino]methyl]phosphanium.
| Compound Name | trihydroxy-[[[4-oxo-4-[3-(propylamino)propylamino]butyl]-(trihydroxyphosphaniumylmethyl)amino]methyl]phosphanium |
|---|---|
| PubChem CID | 91319208 |
| Molecular Formula | C12H31N3O7P2+2 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | trihydroxy-[[[4-oxo-4-[3-(propylamino)propylamino]butyl]-(trihydroxyphosphaniumylmethyl)amino]methyl]phosphanium |
| SMILES | CCCNCCCNC(=O)CCCN(C[P+](O)(O)O)C[P+](O)(O)O |
| InChI | InChI=1S/C12H30N3O7P2/c1-2-6-13-7-4-8-14-12(16)5-3-9-15(10-23(17,18)19)11-24(20,21)22/h13,17-22H,2-11H2,1H3/q+1/p+1 |
| InChIKey | RJSNMVJRGLHYNH-UHFFFAOYSA-O |
| XLogP | -1.03 |
| TPSA | 165.75 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|