C33H32N6O12 — CID 123454570
dimethyl 2-[2-[1-[4-[[2-[[2,5-bis(methoxycarbonyl)phenyl]diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxopropan-2-yl]hydrazinyl]benzene-1,4-dicarboxylate (PubChem CID 123454570) has the molecular formula C33H32N6O12 and a molecular weight of 704.65 g/mol. Its IUPAC name is dimethyl 2-[2-[1-[4-[[2-[[2,5-bis(methoxycarbonyl)phenyl]diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxopropan-2-yl]hydrazinyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[2-[1-[4-[[2-[[2,5-bis(methoxycarbonyl)phenyl]diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxopropan-2-yl]hydrazinyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 123454570 |
| Molecular Formula | C33H32N6O12 |
| Molecular Weight | 704.65 g/mol |
| Exact Mass | 704.21 |
| IUPAC Name | dimethyl 2-[2-[1-[4-[[2-[[2,5-bis(methoxycarbonyl)phenyl]diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxopropan-2-yl]hydrazinyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(/N=N/C(C(C)=O)C(=O)Nc2ccc(NC(=O)C(C=O)NNc3cc(C(=O)OC)ccc3C(=O)OC)cc2)c1 |
| InChI | InChI=1S/C33H32N6O12/c1-17(41)27(39-37-25-15-19(31(45)49-3)7-13-23(25)33(47)51-5)29(43)35-21-10-8-20(9-11-21)34-28(42)26(16-40)38-36-24-14-18(30(44)48-2)6-12-22(24)32(46)50-4/h6-16,26-27,36,38H,1-5H3,(H,34,42)(H,35,43)/b39-37+ |
| InChIKey | MAOHCBWXVAKJDL-NHFVQZBWSA-N |
| XLogP | 2.64 |
| TPSA | 246.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.65 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|