C34H30N6O12 — CID 155260591
dimethyl 2-[[1-[4-[[2-[(2-methoxycarbonyl-5-oxaldehydoylphenyl)diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]benzene-1,4-dicarboxylate (PubChem CID 155260591) has the molecular formula C34H30N6O12 and a molecular weight of 714.64 g/mol. Its IUPAC name is dimethyl 2-[[1-[4-[[2-[(2-methoxycarbonyl-5-oxaldehydoylphenyl)diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[[1-[4-[[2-[(2-methoxycarbonyl-5-oxaldehydoylphenyl)diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 155260591 |
| Molecular Formula | C34H30N6O12 |
| Molecular Weight | 714.64 g/mol |
| Exact Mass | 714.19 |
| IUPAC Name | dimethyl 2-[[1-[4-[[2-[(2-methoxycarbonyl-5-oxaldehydoylphenyl)diazenyl]-3-oxobutanoyl]amino]anilino]-1,3-dioxobutan-2-yl]diazenyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(/N=N/C(C(C)=O)C(=O)Nc2ccc(NC(=O)C(/N=N/c3cc(C(=O)C=O)ccc3C(=O)OC)C(C)=O)cc2)c1 |
| InChI | InChI=1S/C34H30N6O12/c1-17(42)28(39-37-25-14-19(27(44)16-41)6-12-23(25)33(48)51-4)30(45)35-21-8-10-22(11-9-21)36-31(46)29(18(2)43)40-38-26-15-20(32(47)50-3)7-13-24(26)34(49)52-5/h6-16,28-29H,1-5H3,(H,35,45)(H,36,46)/b39-37+,40-38+ |
| InChIKey | PQIQWGIGTBAYEW-HVMBLDELSA-N |
| XLogP | 3.79 |
| TPSA | 254.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|