C17H17ClN4O3 — CID 123457690
5-chloro-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-1-(4-hydroxyphenyl)-4-methylpyrrole-3-carboximidamide (PubChem CID 123457690) has the molecular formula C17H17ClN4O3 and a molecular weight of 360.80 g/mol. Its IUPAC name is 5-chloro-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-1-(4-hydroxyphenyl)-4-methylpyrrole-3-carboximidamide.
| Compound Name | 5-chloro-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-1-(4-hydroxyphenyl)-4-methylpyrrole-3-carboximidamide |
|---|---|
| PubChem CID | 123457690 |
| Molecular Formula | C17H17ClN4O3 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | 5-chloro-2-(3,5-dimethyl-1,2-oxazol-4-yl)-N'-hydroxy-1-(4-hydroxyphenyl)-4-methylpyrrole-3-carboximidamide |
| SMILES | Cc1noc(C)c1-c1c(C(N)=NO)c(C)c(Cl)n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C17H17ClN4O3/c1-8-13(17(19)20-24)15(14-9(2)21-25-10(14)3)22(16(8)18)11-4-6-12(23)7-5-11/h4-7,23-24H,1-3H3,(H2,19,20) |
| InChIKey | NYDRROPVKQGXCA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|