C21H16F3N3O3 — CID 76774516
4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]indol-1-yl]phenol (PubChem CID 76774516) has the molecular formula C21H16F3N3O3 and a molecular weight of 415.37 g/mol. Its IUPAC name is 4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]indol-1-yl]phenol.
| Compound Name | 4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]indol-1-yl]phenol |
|---|---|
| PubChem CID | 76774516 |
| Molecular Formula | C21H16F3N3O3 |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 4-[2-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[N-hydroxy-C-(trifluoromethyl)carbonimidoyl]indol-1-yl]phenol |
| SMILES | Cc1noc(C)c1-c1c(C(=NO)C(F)(F)F)c2ccccc2n1-c1ccc(O)cc1 |
| InChI | InChI=1S/C21H16F3N3O3/c1-11-17(12(2)30-26-11)19-18(20(25-29)21(22,23)24)15-5-3-4-6-16(15)27(19)13-7-9-14(28)10-8-13/h3-10,28-29H,1-2H3 |
| InChIKey | VGKRRJJWKGHZCM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|