C20H15ClN2O3 — CID 87365150
1-(3-chloro-4-hydroxyphenyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)indole-3-carbaldehyde (PubChem CID 87365150) has the molecular formula C20H15ClN2O3 and a molecular weight of 366.80 g/mol. Its IUPAC name is 1-(3-chloro-4-hydroxyphenyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)indole-3-carbaldehyde.
| Compound Name | 1-(3-chloro-4-hydroxyphenyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)indole-3-carbaldehyde |
|---|---|
| PubChem CID | 87365150 |
| Molecular Formula | C20H15ClN2O3 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 1-(3-chloro-4-hydroxyphenyl)-2-(3,5-dimethyl-1,2-oxazol-4-yl)indole-3-carbaldehyde |
| SMILES | Cc1noc(C)c1-c1c(C=O)c2ccccc2n1-c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C20H15ClN2O3/c1-11-19(12(2)26-22-11)20-15(10-24)14-5-3-4-6-17(14)23(20)13-7-8-18(25)16(21)9-13/h3-10,25H,1-2H3 |
| InChIKey | XHOITOLZLHPUSZ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|