C20H33NO5 — CID 123459247
tert-butyl 8-ethenyl-3-methoxy-2,2,3-trimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate (PubChem CID 123459247) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl 8-ethenyl-3-methoxy-2,2,3-trimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate.
| Compound Name | tert-butyl 8-ethenyl-3-methoxy-2,2,3-trimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate |
|---|---|
| PubChem CID | 123459247 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | tert-butyl 8-ethenyl-3-methoxy-2,2,3-trimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate |
| SMILES | C=CC1C2OC(C)(C)C(C)(OC)OC2CN(C(=O)OC(C)(C)C)C12CC2 |
| InChI | InChI=1S/C20H33NO5/c1-9-13-15-14(24-19(7,23-8)18(5,6)25-15)12-21(20(13)10-11-20)16(22)26-17(2,3)4/h9,13-15H,1,10-12H2,2-8H3 |
| InChIKey | KLQSUPBVTWPLTB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|