C22H37NO5 — CID 126501592
tert-butyl (2S,4aR,8S,8aR)-8-[(E)-but-1-enyl]-2-methoxy-2,3,3-trimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate (PubChem CID 126501592) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is tert-butyl (2S,4aR,8S,8aR)-8-[(E)-but-1-enyl]-2-methoxy-2,3,3-trimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate.
| Compound Name | tert-butyl (2S,4aR,8S,8aR)-8-[(E)-but-1-enyl]-2-methoxy-2,3,3-trimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate |
|---|---|
| PubChem CID | 126501592 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | tert-butyl (2S,4aR,8S,8aR)-8-[(E)-but-1-enyl]-2-methoxy-2,3,3-trimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate |
| SMILES | CC/C=C/[C@@H]1[C@H]2O[C@](C)(OC)C(C)(C)O[C@@H]2CN(C(=O)OC(C)(C)C)C12CC2 |
| InChI | InChI=1S/C22H37NO5/c1-9-10-11-15-17-16(26-20(5,6)21(7,25-8)27-17)14-23(22(15)12-13-22)18(24)28-19(2,3)4/h10-11,15-17H,9,12-14H2,1-8H3/b11-10+/t15-,16-,17-,21+/m1/s1 |
| InChIKey | XWQDBTAWUDEOPJ-BIJFDGJFSA-N |
| XLogP | 4.28 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|