C18H29NO7 — CID 126540211
tert-butyl (2S,3S,4aR,8S,8aR)-8-formyl-2-hydroxy-3-methoxy-2,3-dimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate (PubChem CID 126540211) has the molecular formula C18H29NO7 and a molecular weight of 371.43 g/mol. Its IUPAC name is tert-butyl (2S,3S,4aR,8S,8aR)-8-formyl-2-hydroxy-3-methoxy-2,3-dimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate.
| Compound Name | tert-butyl (2S,3S,4aR,8S,8aR)-8-formyl-2-hydroxy-3-methoxy-2,3-dimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate |
|---|---|
| PubChem CID | 126540211 |
| Molecular Formula | C18H29NO7 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | tert-butyl (2S,3S,4aR,8S,8aR)-8-formyl-2-hydroxy-3-methoxy-2,3-dimethylspiro[4a,5,8,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate |
| SMILES | CO[C@@]1(C)O[C@@H]2CN(C(=O)OC(C)(C)C)C3(CC3)[C@H](C=O)[C@H]2O[C@]1(C)O |
| InChI | InChI=1S/C18H29NO7/c1-15(2,3)26-14(21)19-9-12-13(11(10-20)18(19)7-8-18)25-16(4,22)17(5,23-6)24-12/h10-13,22H,7-9H2,1-6H3/t11-,12-,13-,16+,17+/m1/s1 |
| InChIKey | CYXRWORFVPNQBR-LWQKMWDQSA-N |
| XLogP | 1.44 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|