C33H38ClF3N4O5 — CID 123461121
2-chloro-1-[4-[4-[(4-methylphenyl)methoxy]phenyl]piperazin-1-yl]ethanone;4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexan-1-ol (PubChem CID 123461121) has the molecular formula C33H38ClF3N4O5 and a molecular weight of 663.14 g/mol. Its IUPAC name is 2-chloro-1-[4-[4-[(4-methylphenyl)methoxy]phenyl]piperazin-1-yl]ethanone;4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexan-1-ol.
| Compound Name | 2-chloro-1-[4-[4-[(4-methylphenyl)methoxy]phenyl]piperazin-1-yl]ethanone;4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 123461121 |
| Molecular Formula | C33H38ClF3N4O5 |
| Molecular Weight | 663.14 g/mol |
| Exact Mass | 662.25 |
| IUPAC Name | 2-chloro-1-[4-[4-[(4-methylphenyl)methoxy]phenyl]piperazin-1-yl]ethanone;4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexan-1-ol |
| SMILES | Cc1ccc(COc2ccc(N3CCN(C(=O)CCl)CC3)cc2)cc1.O=[N+]([O-])c1ccc(NC2CCC(O)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H23ClN2O2.C13H15F3N2O3/c1-16-2-4-17(5-3-16)15-25-19-8-6-18(7-9-19)22-10-12-23(13-11-22)20(24)14-21;14-13(15,16)11-7-9(3-6-12(11)18(20)21)17-8-1-4-10(19)5-2-8/h2-9H,10-15H2,1H3;3,6-8,10,17,19H,1-2,4-5H2 |
| InChIKey | IZVJRKQRDGBHGE-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.14 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|