C13H17N3O2S — CID 123466898
3-[[4-(1-hydroxy-2-sulfanylethyl)phenyl]methyl]-2-imino-1-methylimidazolidin-4-one (PubChem CID 123466898) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 3-[[4-(1-hydroxy-2-sulfanylethyl)phenyl]methyl]-2-imino-1-methylimidazolidin-4-one.
| Compound Name | 3-[[4-(1-hydroxy-2-sulfanylethyl)phenyl]methyl]-2-imino-1-methylimidazolidin-4-one |
|---|---|
| PubChem CID | 123466898 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 3-[[4-(1-hydroxy-2-sulfanylethyl)phenyl]methyl]-2-imino-1-methylimidazolidin-4-one |
| SMILES | [H]/N=C1\N(C)CC(=O)N1Cc1ccc(C(O)CS)cc1 |
| InChI | InChI=1S/C13H17N3O2S/c1-15-7-12(18)16(13(15)14)6-9-2-4-10(5-3-9)11(17)8-19/h2-5,11,14,17,19H,6-8H2,1H3/b14-13+ |
| InChIKey | QUEWIBZRENOITH-BUHFOSPRSA-N |
| XLogP | 0.86 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|