C13H17NO6 — CID 123467015
4-O-[2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)ethyl] 1-O-methyl but-2-enedioate (PubChem CID 123467015) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-O-[2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)ethyl] 1-O-methyl but-2-enedioate.
| Compound Name | 4-O-[2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)ethyl] 1-O-methyl but-2-enedioate |
|---|---|
| PubChem CID | 123467015 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-O-[2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)ethyl] 1-O-methyl but-2-enedioate |
| SMILES | COC(=O)C=CC(=O)OCCn1c(O)c(C)c(C)c1O |
| InChI | InChI=1S/C13H17NO6/c1-8-9(2)13(18)14(12(8)17)6-7-20-11(16)5-4-10(15)19-3/h4-5,17-18H,6-7H2,1-3H3 |
| InChIKey | FNALJSLJNOEVGB-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|