About [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate
[(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate (PubChem CID 91058886) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate.
Analyze [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate?
The IUPAC name of [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate (CID 91058886) is [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate.
What is the SMILES notation for [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate?
The canonical SMILES for [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate is CC(=O)OC[C@H](C)n1c(O)c(C)c(C)c1O.
What is the InChIKey of [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate?
The InChIKey is WVJZGTYLPJHMCX-LURJTMIESA-N. The full InChI is InChI=1S/C11H17NO4/c1-6(5-16-9(4)13)12-10(14)7(2)8(3)11(12)15/h6,14-15H,5H2,1-4H3/t6-/m0/s1.
What are the key properties of [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate?
[(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate has a molecular weight of 227.26 g/mol, XLogP of 1.64, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propyl] acetate is sourced from PubChem (CID 91058886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).