C10H13NO4 — CID 90898708
2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl prop-2-enoate (PubChem CID 90898708) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl prop-2-enoate.
| Compound Name | 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 90898708 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(2,5-dihydroxy-3-methylpyrrol-1-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C10H13NO4/c1-3-9(13)15-5-4-11-8(12)6-7(2)10(11)14/h3,6,12,14H,1,4-5H2,2H3 |
| InChIKey | XVNCGBUOCYPFIM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|