C8H9NO6S2 — CID 54488044
(acetyloxydisulfanyl) 2-(2,5-dihydroxypyrrol-1-yl)acetate (PubChem CID 54488044) has the molecular formula C8H9NO6S2 and a molecular weight of 279.30 g/mol. Its IUPAC name is (acetyloxydisulfanyl) 2-(2,5-dihydroxypyrrol-1-yl)acetate.
| Compound Name | (acetyloxydisulfanyl) 2-(2,5-dihydroxypyrrol-1-yl)acetate |
|---|---|
| PubChem CID | 54488044 |
| Molecular Formula | C8H9NO6S2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 278.99 |
| IUPAC Name | (acetyloxydisulfanyl) 2-(2,5-dihydroxypyrrol-1-yl)acetate |
| SMILES | CC(=O)OSSOC(=O)Cn1c(O)ccc1O |
| InChI | InChI=1S/C8H9NO6S2/c1-5(10)14-16-17-15-8(13)4-9-6(11)2-3-7(9)12/h2-3,11-12H,4H2,1H3 |
| InChIKey | XTTGKSWZMYJSBN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|