C15H26N2O — CID 123468915
2-(diethylamino)-N-(2,6-dimethylhepta-2,4,6-trienyl)acetamide (PubChem CID 123468915) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,6-dimethylhepta-2,4,6-trienyl)acetamide.
| Compound Name | 2-(diethylamino)-N-(2,6-dimethylhepta-2,4,6-trienyl)acetamide |
|---|---|
| PubChem CID | 123468915 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 2-(diethylamino)-N-(2,6-dimethylhepta-2,4,6-trienyl)acetamide |
| SMILES | C=C(C)C=CC=C(C)CNC(=O)CN(CC)CC |
| InChI | InChI=1S/C15H26N2O/c1-6-17(7-2)12-15(18)16-11-14(5)10-8-9-13(3)4/h8-10H,3,6-7,11-12H2,1-2,4-5H3,(H,16,18) |
| InChIKey | BMFKJDAJBRHDDG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|