C31H31Cl2F3N4O — CID 123469586
N-[3-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propyl]methanimine (PubChem CID 123469586) has the molecular formula C31H31Cl2F3N4O and a molecular weight of 603.52 g/mol. Its IUPAC name is N-[3-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propyl]methanimine.
| Compound Name | N-[3-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propyl]methanimine |
|---|---|
| PubChem CID | 123469586 |
| Molecular Formula | C31H31Cl2F3N4O |
| Molecular Weight | 603.52 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | N-[3-[5-[[4-[(2,6-dichlorophenyl)methyl]piperazin-1-yl]methyl]-3-[4-(trifluoromethoxy)phenyl]indol-1-yl]propyl]methanimine |
| SMILES | C=NCCCn1cc(-c2ccc(OC(F)(F)F)cc2)c2cc(CN3CCN(Cc4c(Cl)cccc4Cl)CC3)ccc21 |
| InChI | InChI=1S/C31H31Cl2F3N4O/c1-37-12-3-13-40-21-26(23-7-9-24(10-8-23)41-31(34,35)36)25-18-22(6-11-30(25)40)19-38-14-16-39(17-15-38)20-27-28(32)4-2-5-29(27)33/h2,4-11,18,21H,1,3,12-17,19-20H2 |
| InChIKey | YWMXUOPOZHCEAX-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 33.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.52 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|