C14H29N — CID 123470247
7,7,9-trimethyl-3-methylidenedecan-2-amine (PubChem CID 123470247) has the molecular formula C14H29N and a molecular weight of 211.39 g/mol. Its IUPAC name is 7,7,9-trimethyl-3-methylidenedecan-2-amine.
| Compound Name | 7,7,9-trimethyl-3-methylidenedecan-2-amine |
|---|---|
| PubChem CID | 123470247 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | 7,7,9-trimethyl-3-methylidenedecan-2-amine |
| SMILES | C=C(CCCC(C)(C)CC(C)C)C(C)N |
| InChI | InChI=1S/C14H29N/c1-11(2)10-14(5,6)9-7-8-12(3)13(4)15/h11,13H,3,7-10,15H2,1-2,4-6H3 |
| InChIKey | ZWFJVAZLFLNBSF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|