C16H30F3N — CID 163840784
(2S,3R)-3-methyl-3-[(2S)-pentan-2-yl]-8-(trifluoromethyl)non-8-en-2-amine (PubChem CID 163840784) has the molecular formula C16H30F3N and a molecular weight of 293.42 g/mol. Its IUPAC name is (2S,3R)-3-methyl-3-[(2S)-pentan-2-yl]-8-(trifluoromethyl)non-8-en-2-amine.
| Compound Name | (2S,3R)-3-methyl-3-[(2S)-pentan-2-yl]-8-(trifluoromethyl)non-8-en-2-amine |
|---|---|
| PubChem CID | 163840784 |
| Molecular Formula | C16H30F3N |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | (2S,3R)-3-methyl-3-[(2S)-pentan-2-yl]-8-(trifluoromethyl)non-8-en-2-amine |
| SMILES | C=C(CCCC[C@@](C)([C@H](C)N)[C@@H](C)CCC)C(F)(F)F |
| InChI | InChI=1S/C16H30F3N/c1-6-9-12(2)15(5,14(4)20)11-8-7-10-13(3)16(17,18)19/h12,14H,3,6-11,20H2,1-2,4-5H3/t12-,14-,15+/m0/s1 |
| InChIKey | OLUHXSLTGBBTMA-AEGPPILISA-N |
| XLogP | 5.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|