C16H30F2O — CID 132603530
4,4-difluoro-2,2-dimethyl-5-methylidenetridecan-3-ol (PubChem CID 132603530) has the molecular formula C16H30F2O and a molecular weight of 276.41 g/mol. Its IUPAC name is 4,4-difluoro-2,2-dimethyl-5-methylidenetridecan-3-ol.
| Compound Name | 4,4-difluoro-2,2-dimethyl-5-methylidenetridecan-3-ol |
|---|---|
| PubChem CID | 132603530 |
| Molecular Formula | C16H30F2O |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 4,4-difluoro-2,2-dimethyl-5-methylidenetridecan-3-ol |
| SMILES | C=C(CCCCCCCC)C(F)(F)C(O)C(C)(C)C |
| InChI | InChI=1S/C16H30F2O/c1-6-7-8-9-10-11-12-13(2)16(17,18)14(19)15(3,4)5/h14,19H,2,6-12H2,1,3-5H3 |
| InChIKey | HUCJIVYPSPJNOU-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|