C7H11F3O3S — CID 123470836
2,2,2-trifluoroethyl pent-1-ene-1-sulfonate (PubChem CID 123470836) has the molecular formula C7H11F3O3S and a molecular weight of 232.22 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl pent-1-ene-1-sulfonate.
| Compound Name | 2,2,2-trifluoroethyl pent-1-ene-1-sulfonate |
|---|---|
| PubChem CID | 123470836 |
| Molecular Formula | C7H11F3O3S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 2,2,2-trifluoroethyl pent-1-ene-1-sulfonate |
| SMILES | CCCC=CS(=O)(=O)OCC(F)(F)F |
| InChI | InChI=1S/C7H11F3O3S/c1-2-3-4-5-14(11,12)13-6-7(8,9)10/h4-5H,2-3,6H2,1H3 |
| InChIKey | UOVSZMSBJSKNSZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|