C21H38 — CID 123472126
6-ethyl-1,3-dimethyl-6-propyl-4-(2,2,3-trimethylcyclopropyl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene (PubChem CID 123472126) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is 6-ethyl-1,3-dimethyl-6-propyl-4-(2,2,3-trimethylcyclopropyl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene.
| Compound Name | 6-ethyl-1,3-dimethyl-6-propyl-4-(2,2,3-trimethylcyclopropyl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
|---|---|
| PubChem CID | 123472126 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | 6-ethyl-1,3-dimethyl-6-propyl-4-(2,2,3-trimethylcyclopropyl)-2,3,3a,4,5,6a-hexahydro-1H-pentalene |
| SMILES | CCCC1(CC)CC(C2C(C)C2(C)C)C2C(C)CC(C)C21 |
| InChI | InChI=1S/C21H38/c1-8-10-21(9-2)12-16(19-15(5)20(19,6)7)17-13(3)11-14(4)18(17)21/h13-19H,8-12H2,1-7H3 |
| InChIKey | BBNWAEBEHCDZLO-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |