C34H38N7O+ — CID 123473084
4-(aminomethyl)-2-[[bis(pyridin-2-ylmethyl)amino]methyl]-6-[[(1-methylpyridin-1-ium-2-yl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol (PubChem CID 123473084) has the molecular formula C34H38N7O+ and a molecular weight of 560.73 g/mol. Its IUPAC name is 4-(aminomethyl)-2-[[bis(pyridin-2-ylmethyl)amino]methyl]-6-[[(1-methylpyridin-1-ium-2-yl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 4-(aminomethyl)-2-[[bis(pyridin-2-ylmethyl)amino]methyl]-6-[[(1-methylpyridin-1-ium-2-yl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 123473084 |
| Molecular Formula | C34H38N7O+ |
| Molecular Weight | 560.73 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 4-(aminomethyl)-2-[[bis(pyridin-2-ylmethyl)amino]methyl]-6-[[(1-methylpyridin-1-ium-2-yl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
| SMILES | C[n+]1ccccc1CN(Cc1ccccn1)Cc1cc(CN)cc(CN(Cc2ccccn2)Cc2ccccn2)c1O |
| InChI | InChI=1S/C34H37N7O/c1-39-17-9-5-13-33(39)26-41(25-32-12-4-8-16-38-32)22-29-19-27(20-35)18-28(34(29)42)21-40(23-30-10-2-6-14-36-30)24-31-11-3-7-15-37-31/h2-19H,20-26,35H2,1H3/p+1 |
| InChIKey | HWGUFLNWHUUJFG-UHFFFAOYSA-O |
| XLogP | 4.27 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.73 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|