C10H21N2+ — CID 123473292
3,5,7,7-tetramethyl-2,3,4,8-tetrahydro-1H-1,5-diazocin-5-ium (PubChem CID 123473292) has the molecular formula C10H21N2+ and a molecular weight of 169.29 g/mol. Its IUPAC name is 3,5,7,7-tetramethyl-2,3,4,8-tetrahydro-1H-1,5-diazocin-5-ium.
| Compound Name | 3,5,7,7-tetramethyl-2,3,4,8-tetrahydro-1H-1,5-diazocin-5-ium |
|---|---|
| PubChem CID | 123473292 |
| Molecular Formula | C10H21N2+ |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.17 |
| IUPAC Name | 3,5,7,7-tetramethyl-2,3,4,8-tetrahydro-1H-1,5-diazocin-5-ium |
| SMILES | CC1CNCC(C)(C)/C=[N+](/C)C1 |
| InChI | InChI=1S/C10H21N2/c1-9-5-11-7-10(2,3)8-12(4)6-9/h8-9,11H,5-7H2,1-4H3/q+1/b12-8- |
| InChIKey | VCYJLPDYSXUWKN-WQLSENKSSA-N |
| XLogP | 0.96 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|