C11H23N — CID 167029164
(6S)-2,2,4,4,6-pentamethylazepane (PubChem CID 167029164) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is (6S)-2,2,4,4,6-pentamethylazepane.
| Compound Name | (6S)-2,2,4,4,6-pentamethylazepane |
|---|---|
| PubChem CID | 167029164 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (6S)-2,2,4,4,6-pentamethylazepane |
| SMILES | C[C@@H]1CNC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C11H23N/c1-9-6-10(2,3)8-11(4,5)12-7-9/h9,12H,6-8H2,1-5H3/t9-/m0/s1 |
| InChIKey | MOTKUFDZNXZSDS-VIFPVBQESA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |