C19H23ClF2N2O — CID 123474831
2-chloro-6-[2-(difluoromethyl)-4-pyridinyl]-3-(2,2,4-trimethylpentoxy)pyridine (PubChem CID 123474831) has the molecular formula C19H23ClF2N2O and a molecular weight of 368.86 g/mol. Its IUPAC name is 2-chloro-6-[2-(difluoromethyl)-4-pyridinyl]-3-(2,2,4-trimethylpentoxy)pyridine.
| Compound Name | 2-chloro-6-[2-(difluoromethyl)-4-pyridinyl]-3-(2,2,4-trimethylpentoxy)pyridine |
|---|---|
| PubChem CID | 123474831 |
| Molecular Formula | C19H23ClF2N2O |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-chloro-6-[2-(difluoromethyl)-4-pyridinyl]-3-(2,2,4-trimethylpentoxy)pyridine |
| SMILES | CC(C)CC(C)(C)COc1ccc(-c2ccnc(C(F)F)c2)nc1Cl |
| InChI | InChI=1S/C19H23ClF2N2O/c1-12(2)10-19(3,4)11-25-16-6-5-14(24-17(16)20)13-7-8-23-15(9-13)18(21)22/h5-9,12,18H,10-11H2,1-4H3 |
| InChIKey | QLZZEIZVBUICJZ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|