C36H39BN6 — CID 123475840
tris[5-(2,4,6-trimethylphenyl)-1H-pyrazol-4-yl]borane (PubChem CID 123475840) has the molecular formula C36H39BN6 and a molecular weight of 566.56 g/mol. Its IUPAC name is tris[5-(2,4,6-trimethylphenyl)-1H-pyrazol-4-yl]borane.
| Compound Name | tris[5-(2,4,6-trimethylphenyl)-1H-pyrazol-4-yl]borane |
|---|---|
| PubChem CID | 123475840 |
| Molecular Formula | C36H39BN6 |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | tris[5-(2,4,6-trimethylphenyl)-1H-pyrazol-4-yl]borane |
| SMILES | Cc1cc(C)c(-c2[nH]ncc2B(c2cn[nH]c2-c2c(C)cc(C)cc2C)c2cn[nH]c2-c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C36H39BN6/c1-19-10-22(4)31(23(5)11-19)34-28(16-38-41-34)37(29-17-39-42-35(29)32-24(6)12-20(2)13-25(32)7)30-18-40-43-36(30)33-26(8)14-21(3)15-27(33)9/h10-18H,1-9H3,(H,38,41)(H,39,42)(H,40,43) |
| InChIKey | XZEIUFNOHRKMIC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|