C17H22N2O — CID 123475923
1-[5-[1-(ethylideneamino)buta-1,3-dien-2-yl]-2-propoxyphenyl]ethanimine (PubChem CID 123475923) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-[5-[1-(ethylideneamino)buta-1,3-dien-2-yl]-2-propoxyphenyl]ethanimine.
| Compound Name | 1-[5-[1-(ethylideneamino)buta-1,3-dien-2-yl]-2-propoxyphenyl]ethanimine |
|---|---|
| PubChem CID | 123475923 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 1-[5-[1-(ethylideneamino)buta-1,3-dien-2-yl]-2-propoxyphenyl]ethanimine |
| SMILES | [H]/N=C(\C)c1cc(C(C=C)=C/N=C/C)ccc1OCCC |
| InChI | InChI=1S/C17H22N2O/c1-5-10-20-17-9-8-15(11-16(17)13(4)18)14(6-2)12-19-7-3/h6-9,11-12,18H,2,5,10H2,1,3-4H3/b14-12?,18-13+,19-7+ |
| InChIKey | KVUOFIRLSQIXHL-QVJOUNDVSA-N |
| XLogP | 4.48 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|