C11H19FN2 — CID 123476203
(6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methanamine (PubChem CID 123476203) has the molecular formula C11H19FN2 and a molecular weight of 198.28 g/mol. Its IUPAC name is (6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methanamine.
| Compound Name | (6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methanamine |
|---|---|
| PubChem CID | 123476203 |
| Molecular Formula | C11H19FN2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | (6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizin-8-yl)methanamine |
| SMILES | C=C(C)C1(F)CN2CCCC2(CN)C1 |
| InChI | InChI=1S/C11H19FN2/c1-9(2)11(12)6-10(7-13)4-3-5-14(10)8-11/h1,3-8,13H2,2H3 |
| InChIKey | TUODEQCZCDRWFC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|