C11H17FN4 — CID 137419728
8-(azidomethyl)-6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizine (PubChem CID 137419728) has the molecular formula C11H17FN4 and a molecular weight of 224.28 g/mol. Its IUPAC name is 8-(azidomethyl)-6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizine.
| Compound Name | 8-(azidomethyl)-6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 137419728 |
| Molecular Formula | C11H17FN4 |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 8-(azidomethyl)-6-fluoro-6-prop-1-en-2-yl-2,3,5,7-tetrahydro-1H-pyrrolizine |
| SMILES | C=C(C)C1(F)CN2CCCC2(CN=[N+]=[N-])C1 |
| InChI | InChI=1S/C11H17FN4/c1-9(2)11(12)6-10(7-14-15-13)4-3-5-16(10)8-11/h1,3-8H2,2H3 |
| InChIKey | NGDFKUHOURBQBM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|