C21H22ClF2N7O — CID 123476445
[6-[3-[3-(3-chloro-5-fluoroanilino)-2-oxopiperidin-1-yl]piperidin-1-yl]-5-fluoropyrimidin-4-yl]cyanamide (PubChem CID 123476445) has the molecular formula C21H22ClF2N7O and a molecular weight of 461.90 g/mol. Its IUPAC name is [6-[3-[3-(3-chloro-5-fluoroanilino)-2-oxopiperidin-1-yl]piperidin-1-yl]-5-fluoropyrimidin-4-yl]cyanamide.
| Compound Name | [6-[3-[3-(3-chloro-5-fluoroanilino)-2-oxopiperidin-1-yl]piperidin-1-yl]-5-fluoropyrimidin-4-yl]cyanamide |
|---|---|
| PubChem CID | 123476445 |
| Molecular Formula | C21H22ClF2N7O |
| Molecular Weight | 461.90 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [6-[3-[3-(3-chloro-5-fluoroanilino)-2-oxopiperidin-1-yl]piperidin-1-yl]-5-fluoropyrimidin-4-yl]cyanamide |
| SMILES | N#CNc1ncnc(N2CCCC(N3CCCC(Nc4cc(F)cc(Cl)c4)C3=O)C2)c1F |
| InChI | InChI=1S/C21H22ClF2N7O/c22-13-7-14(23)9-15(8-13)29-17-4-2-6-31(21(17)32)16-3-1-5-30(10-16)20-18(24)19(26-11-25)27-12-28-20/h7-9,12,16-17,29H,1-6,10H2,(H,26,27,28) |
| InChIKey | JJXAGLLPWLJJCQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.90 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|