C20H24ClFN6O — CID 77392050
1-[1-(6-aminopyrimidin-4-yl)piperidin-3-yl]-3-(3-chloro-5-fluoroanilino)piperidin-2-one (PubChem CID 77392050) has the molecular formula C20H24ClFN6O and a molecular weight of 418.90 g/mol. Its IUPAC name is 1-[1-(6-aminopyrimidin-4-yl)piperidin-3-yl]-3-(3-chloro-5-fluoroanilino)piperidin-2-one.
| Compound Name | 1-[1-(6-aminopyrimidin-4-yl)piperidin-3-yl]-3-(3-chloro-5-fluoroanilino)piperidin-2-one |
|---|---|
| PubChem CID | 77392050 |
| Molecular Formula | C20H24ClFN6O |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 1-[1-(6-aminopyrimidin-4-yl)piperidin-3-yl]-3-(3-chloro-5-fluoroanilino)piperidin-2-one |
| SMILES | Nc1cc(N2CCCC(N3CCCC(Nc4cc(F)cc(Cl)c4)C3=O)C2)ncn1 |
| InChI | InChI=1S/C20H24ClFN6O/c21-13-7-14(22)9-15(8-13)26-17-4-2-6-28(20(17)29)16-3-1-5-27(11-16)19-10-18(23)24-12-25-19/h7-10,12,16-17,26H,1-6,11H2,(H2,23,24,25) |
| InChIKey | YUMPAHNMDIEPPV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |