C15H14N2 — CID 123476841
16-methyl-3,16-diazatricyclo[8.6.0.02,7]hexadeca-1(10),2(7),3,5,8,11,13-heptaene (PubChem CID 123476841) has the molecular formula C15H14N2 and a molecular weight of 222.29 g/mol. Its IUPAC name is 16-methyl-3,16-diazatricyclo[8.6.0.02,7]hexadeca-1(10),2(7),3,5,8,11,13-heptaene.
| Compound Name | 16-methyl-3,16-diazatricyclo[8.6.0.02,7]hexadeca-1(10),2(7),3,5,8,11,13-heptaene |
|---|---|
| PubChem CID | 123476841 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 16-methyl-3,16-diazatricyclo[8.6.0.02,7]hexadeca-1(10),2(7),3,5,8,11,13-heptaene |
| SMILES | CN1CC=CC=Cc2ccc3cccnc3c21 |
| InChI | InChI=1S/C15H14N2/c1-17-11-4-2-3-6-13-9-8-12-7-5-10-16-14(12)15(13)17/h2-10H,11H2,1H3 |
| InChIKey | ZJYDSZWXTBUKID-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |